C54H50N2 — CID 166031792
6-N,17-N-bis(5-tert-butyl-2-methylphenyl)-6-N,17-N-diphenylpentacyclo[10.8.0.02,11.04,9.014,19]icosa-1(12),2(11),3,5,7,9,13,15,17,19-decaene-6,17-diamine (PubChem CID 166031792) has the molecular formula C54H50N2 and a molecular weight of 727.01 g/mol. Its IUPAC name is 6-N,17-N-bis(5-tert-butyl-2-methylphenyl)-6-N,17-N-diphenylpentacyclo[10.8.0.02,11.04,9.014,19]icosa-1(12),2(11),3,5,7,9,13,15,17,19-decaene-6,17-diamine.
| Compound Name | 6-N,17-N-bis(5-tert-butyl-2-methylphenyl)-6-N,17-N-diphenylpentacyclo[10.8.0.02,11.04,9.014,19]icosa-1(12),2(11),3,5,7,9,13,15,17,19-decaene-6,17-diamine |
|---|---|
| PubChem CID | 166031792 |
| Molecular Formula | C54H50N2 |
| Molecular Weight | 727.01 g/mol |
| Exact Mass | 726.40 |
| IUPAC Name | 6-N,17-N-bis(5-tert-butyl-2-methylphenyl)-6-N,17-N-diphenylpentacyclo[10.8.0.02,11.04,9.014,19]icosa-1(12),2(11),3,5,7,9,13,15,17,19-decaene-6,17-diamine |
| SMILES | Cc1ccc(C(C)(C)C)cc1N(c1ccccc1)c1ccc2cc3c(cc2c1)-c1cc2cc(N(c4ccccc4)c4cc(C(C)(C)C)ccc4C)ccc2cc1-3 |
| InChI | InChI=1S/C54H50N2/c1-35-19-23-41(53(3,4)5)33-51(35)55(43-15-11-9-12-16-43)45-25-21-37-29-47-48-30-38-22-26-46(28-40(38)32-50(48)49(47)31-39(37)27-45)56(44-17-13-10-14-18-44)52-34-42(54(6,7)8)24-20-36(52)2/h9-34H,1-8H3 |
| InChIKey | AAXAMZMZJQRHAQ-UHFFFAOYSA-N |
| XLogP | 15.79 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 727.01 |
| LogP ≤ 5 | 15.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |