C62H64N2 — CID 166031875
N,N-bis(5-tert-butyl-2-methylphenyl)-17-(3,6-ditert-butylcarbazol-9-yl)pentacyclo[10.8.0.02,11.04,9.014,19]icosa-1(12),2(11),3,5,7,9,13,15,17,19-decaen-6-amine (PubChem CID 166031875) has the molecular formula C62H64N2 and a molecular weight of 837.21 g/mol. Its IUPAC name is N,N-bis(5-tert-butyl-2-methylphenyl)-17-(3,6-ditert-butylcarbazol-9-yl)pentacyclo[10.8.0.02,11.04,9.014,19]icosa-1(12),2(11),3,5,7,9,13,15,17,19-decaen-6-amine.
| Compound Name | N,N-bis(5-tert-butyl-2-methylphenyl)-17-(3,6-ditert-butylcarbazol-9-yl)pentacyclo[10.8.0.02,11.04,9.014,19]icosa-1(12),2(11),3,5,7,9,13,15,17,19-decaen-6-amine |
|---|---|
| PubChem CID | 166031875 |
| Molecular Formula | C62H64N2 |
| Molecular Weight | 837.21 g/mol |
| Exact Mass | 836.51 |
| IUPAC Name | N,N-bis(5-tert-butyl-2-methylphenyl)-17-(3,6-ditert-butylcarbazol-9-yl)pentacyclo[10.8.0.02,11.04,9.014,19]icosa-1(12),2(11),3,5,7,9,13,15,17,19-decaen-6-amine |
| SMILES | Cc1ccc(C(C)(C)C)cc1N(c1ccc2cc3c(cc2c1)-c1cc2cc(-n4c5ccc(C(C)(C)C)cc5c5cc(C(C)(C)C)ccc54)ccc2cc1-3)c1cc(C(C)(C)C)ccc1C |
| InChI | InChI=1S/C62H64N2/c1-37-15-19-45(61(9,10)11)35-57(37)64(58-36-46(62(12,13)14)20-16-38(58)2)48-24-18-40-30-50-49-29-39-17-23-47(27-41(39)31-51(49)52(50)32-42(40)28-48)63-55-25-21-43(59(3,4)5)33-53(55)54-34-44(60(6,7)8)22-26-56(54)63/h15-36H,1-14H3 |
| InChIKey | UMXOJHBFOSJBOQ-UHFFFAOYSA-N |
| XLogP | 18.01 |
| TPSA | 8.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 64 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 837.21 |
| LogP ≤ 5 | 18.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |