C54H49N — CID 166033205
16,17-bis(4-tert-butylphenyl)-N-(2,6-dimethylphenyl)-N-phenylpentacyclo[10.8.0.02,11.04,9.014,19]icosa-1(20),2(11),3,5,7,9,12,14,16,18-decaen-6-amine (PubChem CID 166033205) has the molecular formula C54H49N and a molecular weight of 711.99 g/mol. Its IUPAC name is 16,17-bis(4-tert-butylphenyl)-N-(2,6-dimethylphenyl)-N-phenylpentacyclo[10.8.0.02,11.04,9.014,19]icosa-1(20),2(11),3,5,7,9,12,14,16,18-decaen-6-amine.
| Compound Name | 16,17-bis(4-tert-butylphenyl)-N-(2,6-dimethylphenyl)-N-phenylpentacyclo[10.8.0.02,11.04,9.014,19]icosa-1(20),2(11),3,5,7,9,12,14,16,18-decaen-6-amine |
|---|---|
| PubChem CID | 166033205 |
| Molecular Formula | C54H49N |
| Molecular Weight | 711.99 g/mol |
| Exact Mass | 711.39 |
| IUPAC Name | 16,17-bis(4-tert-butylphenyl)-N-(2,6-dimethylphenyl)-N-phenylpentacyclo[10.8.0.02,11.04,9.014,19]icosa-1(20),2(11),3,5,7,9,12,14,16,18-decaen-6-amine |
| SMILES | Cc1cccc(C)c1N(c1ccccc1)c1ccc2cc3c(cc2c1)-c1cc2cc(-c4ccc(C(C)(C)C)cc4)c(-c4ccc(C(C)(C)C)cc4)cc2cc1-3 |
| InChI | InChI=1S/C54H49N/c1-34-13-12-14-35(2)52(34)55(44-15-10-9-11-16-44)45-26-21-38-28-48-49(31-39(38)27-45)51-33-41-30-47(37-19-24-43(25-20-37)54(6,7)8)46(29-40(41)32-50(48)51)36-17-22-42(23-18-36)53(3,4)5/h9-33H,1-8H3 |
| InChIKey | ILRHVSCNMXCPNS-UHFFFAOYSA-N |
| XLogP | 15.66 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 711.99 |
| LogP ≤ 5 | 15.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |