C52H42N2 — CID 166037219
4-[2-[2-[3-(1-adamantyl)carbazol-9-yl]phenyl]phenyl]-1,2,3,5,6,7,8-heptadeuterio-9-(2,3,4,5,6-pentadeuteriophenyl)carbazole (PubChem CID 166037219) has the molecular formula C52H42N2 and a molecular weight of 707.00 g/mol. Its IUPAC name is 4-[2-[2-[3-(1-adamantyl)carbazol-9-yl]phenyl]phenyl]-1,2,3,5,6,7,8-heptadeuterio-9-(2,3,4,5,6-pentadeuteriophenyl)carbazole.
| Compound Name | 4-[2-[2-[3-(1-adamantyl)carbazol-9-yl]phenyl]phenyl]-1,2,3,5,6,7,8-heptadeuterio-9-(2,3,4,5,6-pentadeuteriophenyl)carbazole |
|---|---|
| PubChem CID | 166037219 |
| Molecular Formula | C52H42N2 |
| Molecular Weight | 707.00 g/mol |
| Exact Mass | 706.41 |
| IUPAC Name | 4-[2-[2-[3-(1-adamantyl)carbazol-9-yl]phenyl]phenyl]-1,2,3,5,6,7,8-heptadeuterio-9-(2,3,4,5,6-pentadeuteriophenyl)carbazole |
| SMILES | [2H]c1c([2H])c([2H])c(-n2c3c([2H])c([2H])c([2H])c([2H])c3c3c(-c4ccccc4-c4ccccc4-n4c5ccccc5c5cc(C67CC8CC(CC(C8)C6)C7)ccc54)c([2H])c([2H])c([2H])c32)c([2H])c1[2H] |
| InChI | InChI=1S/C52H42N2/c1-2-13-38(14-3-1)53-48-23-11-8-19-44(48)51-43(20-12-24-50(51)53)40-16-5-4-15-39(40)41-17-6-9-21-46(41)54-47-22-10-7-18-42(47)45-30-37(25-26-49(45)54)52-31-34-27-35(32-52)29-36(28-34)33-52/h1-26,30,34-36H,27-29,31-33H2/i1D,2D,3D,8D,11D,12D,13D,14D,19D,20D,23D,24D |
| InChIKey | VTOFKTIDKJLWRM-KERKZRCHSA-N |
| XLogP | 13.68 |
| TPSA | 9.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 707.00 |
| LogP ≤ 5 | 13.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |