C48H31NS — CID 166037337
9-[2-[3-(1,3,4,6,7,8,9-heptadeuteriodibenzothiophen-2-yl)phenyl]phenyl]-3,6-diphenylcarbazole (PubChem CID 166037337) has the molecular formula C48H31NS and a molecular weight of 660.89 g/mol. Its IUPAC name is 9-[2-[3-(1,3,4,6,7,8,9-heptadeuteriodibenzothiophen-2-yl)phenyl]phenyl]-3,6-diphenylcarbazole.
| Compound Name | 9-[2-[3-(1,3,4,6,7,8,9-heptadeuteriodibenzothiophen-2-yl)phenyl]phenyl]-3,6-diphenylcarbazole |
|---|---|
| PubChem CID | 166037337 |
| Molecular Formula | C48H31NS |
| Molecular Weight | 660.89 g/mol |
| Exact Mass | 660.26 |
| IUPAC Name | 9-[2-[3-(1,3,4,6,7,8,9-heptadeuteriodibenzothiophen-2-yl)phenyl]phenyl]-3,6-diphenylcarbazole |
| SMILES | [2H]c1c([2H])c([2H])c2c(sc3c([2H])c([2H])c(-c4cccc(-c5ccccc5-n5c6ccc(-c7ccccc7)cc6c6cc(-c7ccccc7)ccc65)c4)c([2H])c32)c1[2H] |
| InChI | InChI=1S/C48H31NS/c1-3-12-32(13-4-1)35-22-25-45-41(29-35)42-30-36(33-14-5-2-6-15-33)23-26-46(42)49(45)44-20-9-7-18-39(44)38-17-11-16-34(28-38)37-24-27-48-43(31-37)40-19-8-10-21-47(40)50-48/h1-31H/i8D,10D,19D,21D,24D,27D,31D |
| InChIKey | AMZJSHUWHGSVCD-RBQXLUGOSA-N |
| XLogP | 13.82 |
| TPSA | 4.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 660.89 |
| LogP ≤ 5 | 13.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |