C13H8F2N6 — CID 166043233
8-(2,6-difluorophenyl)-3,4,7,9,12,13-hexazatricyclo[8.3.0.02,6]trideca-1(10),2(6),4,7,11-pentaene (PubChem CID 166043233) has the molecular formula C13H8F2N6 and a molecular weight of 286.25 g/mol. Its IUPAC name is 8-(2,6-difluorophenyl)-3,4,7,9,12,13-hexazatricyclo[8.3.0.02,6]trideca-1(10),2(6),4,7,11-pentaene.
| Compound Name | 8-(2,6-difluorophenyl)-3,4,7,9,12,13-hexazatricyclo[8.3.0.02,6]trideca-1(10),2(6),4,7,11-pentaene |
|---|---|
| PubChem CID | 166043233 |
| Molecular Formula | C13H8F2N6 |
| Molecular Weight | 286.25 g/mol |
| Exact Mass | 286.08 |
| IUPAC Name | 8-(2,6-difluorophenyl)-3,4,7,9,12,13-hexazatricyclo[8.3.0.02,6]trideca-1(10),2(6),4,7,11-pentaene |
| SMILES | Fc1cccc(F)c1C1=Nc2cn[nH]c2-c2[nH]ncc2N1 |
| InChI | InChI=1S/C13H8F2N6/c14-6-2-1-3-7(15)10(6)13-18-8-4-16-20-11(8)12-9(19-13)5-17-21-12/h1-5H,(H,16,20)(H,17,21)(H,18,19) |
| InChIKey | CXUOPUDUXOWREQ-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 81.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.25 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |