C19H18F2N8 — CID 170547177
8-(2,6-difluorophenyl)-12-(4-methylpiperazin-1-yl)-3,4,7,9,11,13-hexazatricyclo[8.4.0.02,6]tetradeca-1(14),2(6),4,8,10,12-hexaene (PubChem CID 170547177) has the molecular formula C19H18F2N8 and a molecular weight of 396.41 g/mol. Its IUPAC name is 8-(2,6-difluorophenyl)-12-(4-methylpiperazin-1-yl)-3,4,7,9,11,13-hexazatricyclo[8.4.0.02,6]tetradeca-1(14),2(6),4,8,10,12-hexaene.
| Compound Name | 8-(2,6-difluorophenyl)-12-(4-methylpiperazin-1-yl)-3,4,7,9,11,13-hexazatricyclo[8.4.0.02,6]tetradeca-1(14),2(6),4,8,10,12-hexaene |
|---|---|
| PubChem CID | 170547177 |
| Molecular Formula | C19H18F2N8 |
| Molecular Weight | 396.41 g/mol |
| Exact Mass | 396.16 |
| IUPAC Name | 8-(2,6-difluorophenyl)-12-(4-methylpiperazin-1-yl)-3,4,7,9,11,13-hexazatricyclo[8.4.0.02,6]tetradeca-1(14),2(6),4,8,10,12-hexaene |
| SMILES | CN1CCN(c2ncc3c(n2)N=C(c2c(F)cccc2F)Nc2cn[nH]c2-3)CC1 |
| InChI | InChI=1S/C19H18F2N8/c1-28-5-7-29(8-6-28)19-22-9-11-16-14(10-23-27-16)24-18(25-17(11)26-19)15-12(20)3-2-4-13(15)21/h2-4,9-10H,5-8H2,1H3,(H,23,27)(H,22,24,25,26) |
| InChIKey | SSBKDRJFSIAEIQ-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 85.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.41 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |