C16H9ClF2N4 — CID 166043262
5-(3-chloro-2,6-difluorophenyl)-1,4-dihydropyrazolo[4,5-d][1,3]benzodiazepine (PubChem CID 166043262) has the molecular formula C16H9ClF2N4 and a molecular weight of 330.73 g/mol. Its IUPAC name is 5-(3-chloro-2,6-difluorophenyl)-1,4-dihydropyrazolo[4,5-d][1,3]benzodiazepine.
| Compound Name | 5-(3-chloro-2,6-difluorophenyl)-1,4-dihydropyrazolo[4,5-d][1,3]benzodiazepine |
|---|---|
| PubChem CID | 166043262 |
| Molecular Formula | C16H9ClF2N4 |
| Molecular Weight | 330.73 g/mol |
| Exact Mass | 330.05 |
| IUPAC Name | 5-(3-chloro-2,6-difluorophenyl)-1,4-dihydropyrazolo[4,5-d][1,3]benzodiazepine |
| SMILES | Fc1ccc(Cl)c(F)c1C1=Nc2ccccc2-c2[nH]ncc2N1 |
| InChI | InChI=1S/C16H9ClF2N4/c17-9-5-6-10(18)13(14(9)19)16-21-11-4-2-1-3-8(11)15-12(22-16)7-20-23-15/h1-7H,(H,20,23)(H,21,22) |
| InChIKey | OUHVNAHUQDPACO-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 53.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.73 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|