C16H14ClF2NO — CID 166045392
(3-chloro-2,4-difluorophenyl)-(3,4-dihydro-2H-chromen-3-yl)methanamine (PubChem CID 166045392) has the molecular formula C16H14ClF2NO and a molecular weight of 309.74 g/mol. Its IUPAC name is (3-chloro-2,4-difluorophenyl)-(3,4-dihydro-2H-chromen-3-yl)methanamine.
| Compound Name | (3-chloro-2,4-difluorophenyl)-(3,4-dihydro-2H-chromen-3-yl)methanamine |
|---|---|
| PubChem CID | 166045392 |
| Molecular Formula | C16H14ClF2NO |
| Molecular Weight | 309.74 g/mol |
| Exact Mass | 309.07 |
| IUPAC Name | (3-chloro-2,4-difluorophenyl)-(3,4-dihydro-2H-chromen-3-yl)methanamine |
| SMILES | NC(c1ccc(F)c(Cl)c1F)C1COc2ccccc2C1 |
| InChI | InChI=1S/C16H14ClF2NO/c17-14-12(18)6-5-11(15(14)19)16(20)10-7-9-3-1-2-4-13(9)21-8-10/h1-6,10,16H,7-8,20H2 |
| InChIKey | CHORYTQYBYCCNW-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.74 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|