C18H20ClF4N3O2 — CID 166045454
(2R)-N-[(3-chloro-2,4-difluorophenyl)-[3-(difluoromethyl)cyclobutyl]methyl]-2-methyl-3-oxopiperazine-1-carboxamide (PubChem CID 166045454) has the molecular formula C18H20ClF4N3O2 and a molecular weight of 421.82 g/mol. Its IUPAC name is (2R)-N-[(3-chloro-2,4-difluorophenyl)-[3-(difluoromethyl)cyclobutyl]methyl]-2-methyl-3-oxopiperazine-1-carboxamide.
| Compound Name | (2R)-N-[(3-chloro-2,4-difluorophenyl)-[3-(difluoromethyl)cyclobutyl]methyl]-2-methyl-3-oxopiperazine-1-carboxamide |
|---|---|
| PubChem CID | 166045454 |
| Molecular Formula | C18H20ClF4N3O2 |
| Molecular Weight | 421.82 g/mol |
| Exact Mass | 421.12 |
| IUPAC Name | (2R)-N-[(3-chloro-2,4-difluorophenyl)-[3-(difluoromethyl)cyclobutyl]methyl]-2-methyl-3-oxopiperazine-1-carboxamide |
| SMILES | C[C@@H]1C(=O)NCCN1C(=O)NC(c1ccc(F)c(Cl)c1F)C1CC(C(F)F)C1 |
| InChI | InChI=1S/C18H20ClF4N3O2/c1-8-17(27)24-4-5-26(8)18(28)25-15(9-6-10(7-9)16(22)23)11-2-3-12(20)13(19)14(11)21/h2-3,8-10,15-16H,4-7H2,1H3,(H,24,27)(H,25,28)/t8-,9?,10?,15?/m1/s1 |
| InChIKey | YACQLPOZYSDRFQ-DGWTXQKHSA-N |
| XLogP | 3.48 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.82 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|