C18H20ClF2N3O2 — CID 166045468
(2R)-N-[(3-chloro-2,4-difluorophenyl)-(3-methylidenecyclobutyl)methyl]-2-methyl-3-oxopiperazine-1-carboxamide (PubChem CID 166045468) has the molecular formula C18H20ClF2N3O2 and a molecular weight of 383.83 g/mol. Its IUPAC name is (2R)-N-[(3-chloro-2,4-difluorophenyl)-(3-methylidenecyclobutyl)methyl]-2-methyl-3-oxopiperazine-1-carboxamide.
| Compound Name | (2R)-N-[(3-chloro-2,4-difluorophenyl)-(3-methylidenecyclobutyl)methyl]-2-methyl-3-oxopiperazine-1-carboxamide |
|---|---|
| PubChem CID | 166045468 |
| Molecular Formula | C18H20ClF2N3O2 |
| Molecular Weight | 383.83 g/mol |
| Exact Mass | 383.12 |
| IUPAC Name | (2R)-N-[(3-chloro-2,4-difluorophenyl)-(3-methylidenecyclobutyl)methyl]-2-methyl-3-oxopiperazine-1-carboxamide |
| SMILES | C=C1CC(C(NC(=O)N2CCNC(=O)[C@H]2C)c2ccc(F)c(Cl)c2F)C1 |
| InChI | InChI=1S/C18H20ClF2N3O2/c1-9-7-11(8-9)16(12-3-4-13(20)14(19)15(12)21)23-18(26)24-6-5-22-17(25)10(24)2/h3-4,10-11,16H,1,5-8H2,2H3,(H,22,25)(H,23,26)/t10-,16?/m1/s1 |
| InChIKey | NCBMQBUBXVGHIM-HQNRFAHOSA-N |
| XLogP | 3.16 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.83 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|