C48H31NO — CID 166047099
1,2,4,5,7,8-hexadeuterio-9-[4-(4-dibenzofuran-2-ylphenyl)phenyl]-3,6-bis(2,3,4,5,6-pentadeuteriophenyl)carbazole (PubChem CID 166047099) has the molecular formula C48H31NO and a molecular weight of 653.88 g/mol. Its IUPAC name is 1,2,4,5,7,8-hexadeuterio-9-[4-(4-dibenzofuran-2-ylphenyl)phenyl]-3,6-bis(2,3,4,5,6-pentadeuteriophenyl)carbazole.
| Compound Name | 1,2,4,5,7,8-hexadeuterio-9-[4-(4-dibenzofuran-2-ylphenyl)phenyl]-3,6-bis(2,3,4,5,6-pentadeuteriophenyl)carbazole |
|---|---|
| PubChem CID | 166047099 |
| Molecular Formula | C48H31NO |
| Molecular Weight | 653.88 g/mol |
| Exact Mass | 653.34 |
| IUPAC Name | 1,2,4,5,7,8-hexadeuterio-9-[4-(4-dibenzofuran-2-ylphenyl)phenyl]-3,6-bis(2,3,4,5,6-pentadeuteriophenyl)carbazole |
| SMILES | [2H]c1c([2H])c([2H])c(-c2c([2H])c([2H])c3c(c2[2H])c2c([2H])c(-c4c([2H])c([2H])c([2H])c([2H])c4[2H])c([2H])c([2H])c2n3-c2ccc(-c3ccc(-c4ccc5oc6ccccc6c5c4)cc3)cc2)c([2H])c1[2H] |
| InChI | InChI=1S/C48H31NO/c1-3-9-32(10-4-1)37-21-26-45-42(29-37)43-30-38(33-11-5-2-6-12-33)22-27-46(43)49(45)40-24-19-35(20-25-40)34-15-17-36(18-16-34)39-23-28-48-44(31-39)41-13-7-8-14-47(41)50-48/h1-31H/i1D,2D,3D,4D,5D,6D,9D,10D,11D,12D,21D,22D,26D,27D,29D,30D |
| InChIKey | QDFCRZUKJKSTJY-KSFYWNQLSA-N |
| XLogP | 13.35 |
| TPSA | 18.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 653.88 |
| LogP ≤ 5 | 13.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |