(6-chloro-9-phenylcarbazol-1-yl)boronic acid

C18H13BClNO2 — CID 166049001

IUPAC(6-chloro-9-phenylcarbazol-1-yl)boronic acid
SMILESOB(O)c1cccc2c3cc(Cl)ccc3n(-c3ccccc3)c12
InChIInChI=1S/C18H13BClNO2/c20-12-9-10-17-15(11-12)14-7-4-8-16(19(22)23)18(14)21(17)13-5-2-1-3-6-13/h1-11,22-23H
InChIKeyBGAQRDCRMZGUGI-UHFFFAOYSA-N
MW321.57 g/mol
LogP3.12
Rot. Bonds2

About (6-chloro-9-phenylcarbazol-1-yl)boronic acid

(6-chloro-9-phenylcarbazol-1-yl)boronic acid (PubChem CID 166049001) has the molecular formula C18H13BClNO2 and a molecular weight of 321.57 g/mol. Its IUPAC name is (6-chloro-9-phenylcarbazol-1-yl)boronic acid.

Molecular Properties

Compound Name(6-chloro-9-phenylcarbazol-1-yl)boronic acid
PubChem CID166049001
Molecular FormulaC18H13BClNO2
Molecular Weight321.57 g/mol
Exact Mass321.07
IUPAC Name(6-chloro-9-phenylcarbazol-1-yl)boronic acid
SMILESOB(O)c1cccc2c3cc(Cl)ccc3n(-c3ccccc3)c12
InChIInChI=1S/C18H13BClNO2/c20-12-9-10-17-15(11-12)14-7-4-8-16(19(22)23)18(14)21(17)13-5-2-1-3-6-13/h1-11,22-23H
InChIKeyBGAQRDCRMZGUGI-UHFFFAOYSA-N
XLogP3.12
TPSA45.39 Ų
H-Bond Donors2
H-Bond Acceptors3
Rotatable Bonds2
Heavy Atoms23
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500321.57
LogP ≤ 53.12
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'heavy_metal', 'substructure': 'N/A'}

Analyze (6-chloro-9-phenylcarbazol-1-yl)boronic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (6-chloro-9-phenylcarbazol-1-yl)boronic acid?
The IUPAC name of (6-chloro-9-phenylcarbazol-1-yl)boronic acid (CID 166049001) is (6-chloro-9-phenylcarbazol-1-yl)boronic acid.
What is the SMILES notation for (6-chloro-9-phenylcarbazol-1-yl)boronic acid?
The canonical SMILES for (6-chloro-9-phenylcarbazol-1-yl)boronic acid is OB(O)c1cccc2c3cc(Cl)ccc3n(-c3ccccc3)c12.
What is the InChIKey of (6-chloro-9-phenylcarbazol-1-yl)boronic acid?
The InChIKey is BGAQRDCRMZGUGI-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H13BClNO2/c20-12-9-10-17-15(11-12)14-7-4-8-16(19(22)23)18(14)21(17)13-5-2-1-3-6-13/h1-11,22-23H.
What are the key properties of (6-chloro-9-phenylcarbazol-1-yl)boronic acid?
(6-chloro-9-phenylcarbazol-1-yl)boronic acid has a molecular weight of 321.57 g/mol, XLogP of 3.12, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (6-chloro-9-phenylcarbazol-1-yl)boronic acid is sourced from PubChem (CID 166049001), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).