ethane;(9-phenylcarbazol-4-yl)boronic acid

C20H20BNO2 — CID 178110282

IUPACethane;(9-phenylcarbazol-4-yl)boronic acid
SMILESCC.OB(O)c1cccc2c1c1ccccc1n2-c1ccccc1
InChIInChI=1S/C18H14BNO2.C2H6/c21-19(22)15-10-6-12-17-18(15)14-9-4-5-11-16(14)20(17)13-7-2-1-3-8-13;1-2/h1-12,21-22H;1-2H3
InChIKeyZRSKYZWBLWVSMU-UHFFFAOYSA-N
MW317.20 g/mol
LogP3.49
Rot. Bonds2

About ethane;(9-phenylcarbazol-4-yl)boronic acid

ethane;(9-phenylcarbazol-4-yl)boronic acid (PubChem CID 178110282) has the molecular formula C20H20BNO2 and a molecular weight of 317.20 g/mol. Its IUPAC name is ethane;(9-phenylcarbazol-4-yl)boronic acid.

Molecular Properties

Compound Nameethane;(9-phenylcarbazol-4-yl)boronic acid
PubChem CID178110282
Molecular FormulaC20H20BNO2
Molecular Weight317.20 g/mol
Exact Mass317.16
IUPAC Nameethane;(9-phenylcarbazol-4-yl)boronic acid
SMILESCC.OB(O)c1cccc2c1c1ccccc1n2-c1ccccc1
InChIInChI=1S/C18H14BNO2.C2H6/c21-19(22)15-10-6-12-17-18(15)14-9-4-5-11-16(14)20(17)13-7-2-1-3-8-13;1-2/h1-12,21-22H;1-2H3
InChIKeyZRSKYZWBLWVSMU-UHFFFAOYSA-N
XLogP3.49
TPSA45.39 Ų
H-Bond Donors2
H-Bond Acceptors3
Rotatable Bonds2
Heavy Atoms24
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500317.20
LogP ≤ 53.49
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'heavy_metal', 'substructure': 'N/A'}

Analyze ethane;(9-phenylcarbazol-4-yl)boronic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of ethane;(9-phenylcarbazol-4-yl)boronic acid?
The IUPAC name of ethane;(9-phenylcarbazol-4-yl)boronic acid (CID 178110282) is ethane;(9-phenylcarbazol-4-yl)boronic acid.
What is the SMILES notation for ethane;(9-phenylcarbazol-4-yl)boronic acid?
The canonical SMILES for ethane;(9-phenylcarbazol-4-yl)boronic acid is CC.OB(O)c1cccc2c1c1ccccc1n2-c1ccccc1.
What is the InChIKey of ethane;(9-phenylcarbazol-4-yl)boronic acid?
The InChIKey is ZRSKYZWBLWVSMU-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H14BNO2.C2H6/c21-19(22)15-10-6-12-17-18(15)14-9-4-5-11-16(14)20(17)13-7-2-1-3-8-13;1-2/h1-12,21-22H;1-2H3.
What are the key properties of ethane;(9-phenylcarbazol-4-yl)boronic acid?
ethane;(9-phenylcarbazol-4-yl)boronic acid has a molecular weight of 317.20 g/mol, XLogP of 3.49, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;(9-phenylcarbazol-4-yl)boronic acid is sourced from PubChem (CID 178110282), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).