C23H17FIN3O2 — CID 166050617
N-[(3-fluoro-4-pyridinyl)methyl]-3-(7-iodoquinolin-4-yl)oxy-2-methylbenzamide (PubChem CID 166050617) has the molecular formula C23H17FIN3O2 and a molecular weight of 513.31 g/mol. Its IUPAC name is N-[(3-fluoro-4-pyridinyl)methyl]-3-(7-iodoquinolin-4-yl)oxy-2-methylbenzamide.
| Compound Name | N-[(3-fluoro-4-pyridinyl)methyl]-3-(7-iodoquinolin-4-yl)oxy-2-methylbenzamide |
|---|---|
| PubChem CID | 166050617 |
| Molecular Formula | C23H17FIN3O2 |
| Molecular Weight | 513.31 g/mol |
| Exact Mass | 513.03 |
| IUPAC Name | N-[(3-fluoro-4-pyridinyl)methyl]-3-(7-iodoquinolin-4-yl)oxy-2-methylbenzamide |
| SMILES | Cc1c(Oc2ccnc3cc(I)ccc23)cccc1C(=O)NCc1ccncc1F |
| InChI | InChI=1S/C23H17FIN3O2/c1-14-17(23(29)28-12-15-7-9-26-13-19(15)24)3-2-4-21(14)30-22-8-10-27-20-11-16(25)5-6-18(20)22/h2-11,13H,12H2,1H3,(H,28,29) |
| InChIKey | ZXWKKVKDAVFILJ-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.31 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|