C26H21FNOS+ — CID 166051831
2-[6-(5,6-dihydro-4H-cyclopenta[b]thiophen-2-yl)-7-fluoro-3-methyldibenzofuran-4-yl]-1-methylpyridin-1-ium (PubChem CID 166051831) has the molecular formula C26H21FNOS+ and a molecular weight of 414.53 g/mol. Its IUPAC name is 2-[6-(5,6-dihydro-4H-cyclopenta[b]thiophen-2-yl)-7-fluoro-3-methyldibenzofuran-4-yl]-1-methylpyridin-1-ium.
| Compound Name | 2-[6-(5,6-dihydro-4H-cyclopenta[b]thiophen-2-yl)-7-fluoro-3-methyldibenzofuran-4-yl]-1-methylpyridin-1-ium |
|---|---|
| PubChem CID | 166051831 |
| Molecular Formula | C26H21FNOS+ |
| Molecular Weight | 414.53 g/mol |
| Exact Mass | 414.13 |
| IUPAC Name | 2-[6-(5,6-dihydro-4H-cyclopenta[b]thiophen-2-yl)-7-fluoro-3-methyldibenzofuran-4-yl]-1-methylpyridin-1-ium |
| SMILES | Cc1ccc2c(oc3c(-c4cc5c(s4)CCC5)c(F)ccc32)c1-c1cccc[n+]1C |
| InChI | InChI=1S/C26H21FNOS/c1-15-9-10-17-18-11-12-19(27)24(22-14-16-6-5-8-21(16)30-22)26(18)29-25(17)23(15)20-7-3-4-13-28(20)2/h3-4,7,9-14H,5-6,8H2,1-2H3/q+1 |
| InChIKey | AGHHZOWNDVTTQA-UHFFFAOYSA-N |
| XLogP | 6.74 |
| TPSA | 17.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.53 |
| LogP ≤ 5 | 6.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|