C23H17F3NO+ — CID 166053139
3,19,20-trimethyl-7-(trifluoromethyl)-12-oxa-3-azoniapentacyclo[11.7.1.02,11.05,10.017,21]henicosa-1(20),2,4,6,8,10,13,15,17(21),18-decaene (PubChem CID 166053139) has the molecular formula C23H17F3NO+ and a molecular weight of 380.39 g/mol. Its IUPAC name is 3,19,20-trimethyl-7-(trifluoromethyl)-12-oxa-3-azoniapentacyclo[11.7.1.02,11.05,10.017,21]henicosa-1(20),2,4,6,8,10,13,15,17(21),18-decaene.
| Compound Name | 3,19,20-trimethyl-7-(trifluoromethyl)-12-oxa-3-azoniapentacyclo[11.7.1.02,11.05,10.017,21]henicosa-1(20),2,4,6,8,10,13,15,17(21),18-decaene |
|---|---|
| PubChem CID | 166053139 |
| Molecular Formula | C23H17F3NO+ |
| Molecular Weight | 380.39 g/mol |
| Exact Mass | 380.13 |
| IUPAC Name | 3,19,20-trimethyl-7-(trifluoromethyl)-12-oxa-3-azoniapentacyclo[11.7.1.02,11.05,10.017,21]henicosa-1(20),2,4,6,8,10,13,15,17(21),18-decaene |
| SMILES | Cc1cc2cccc3c2c(c1C)-c1c(c2ccc(C(F)(F)F)cc2c[n+]1C)O3 |
| InChI | InChI=1S/C23H17F3NO/c1-12-9-14-5-4-6-18-20(14)19(13(12)2)21-22(28-18)17-8-7-16(23(24,25)26)10-15(17)11-27(21)3/h4-11H,1-3H3/q+1 |
| InChIKey | YBYGHIAJIOPNDS-UHFFFAOYSA-N |
| XLogP | 6.23 |
| TPSA | 13.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.39 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|