C23H25FNO+ — CID 166053671
11-(2,2-dimethylpropyl)-6-fluoro-3,15,16-trimethyl-8-oxa-3-azoniatetracyclo[7.7.1.02,7.013,17]heptadeca-1(16),2,4,6,9,11,13(17),14-octaene (PubChem CID 166053671) has the molecular formula C23H25FNO+ and a molecular weight of 350.46 g/mol. Its IUPAC name is 11-(2,2-dimethylpropyl)-6-fluoro-3,15,16-trimethyl-8-oxa-3-azoniatetracyclo[7.7.1.02,7.013,17]heptadeca-1(16),2,4,6,9,11,13(17),14-octaene.
| Compound Name | 11-(2,2-dimethylpropyl)-6-fluoro-3,15,16-trimethyl-8-oxa-3-azoniatetracyclo[7.7.1.02,7.013,17]heptadeca-1(16),2,4,6,9,11,13(17),14-octaene |
|---|---|
| PubChem CID | 166053671 |
| Molecular Formula | C23H25FNO+ |
| Molecular Weight | 350.46 g/mol |
| Exact Mass | 350.19 |
| IUPAC Name | 11-(2,2-dimethylpropyl)-6-fluoro-3,15,16-trimethyl-8-oxa-3-azoniatetracyclo[7.7.1.02,7.013,17]heptadeca-1(16),2,4,6,9,11,13(17),14-octaene |
| SMILES | Cc1cc2cc(CC(C)(C)C)cc3c2c(c1C)-c1c(c(F)cc[n+]1C)O3 |
| InChI | InChI=1S/C23H25FNO/c1-13-9-16-10-15(12-23(3,4)5)11-18-20(16)19(14(13)2)21-22(26-18)17(24)7-8-25(21)6/h7-11H,12H2,1-6H3/q+1 |
| InChIKey | YHQHEKQHWIWHDT-UHFFFAOYSA-N |
| XLogP | 5.78 |
| TPSA | 13.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.46 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|