C29H34IrNO3- — CID 166053857
CID 166053857 (PubChem CID 166053857) has the molecular formula C29H34IrNO3- and a molecular weight of 636.81 g/mol.
| Compound Name | CID 166053857 |
|---|---|
| PubChem CID | 166053857 |
| Molecular Formula | C29H34IrNO3- |
| Molecular Weight | 636.81 g/mol |
| Exact Mass | 637.22 |
| IUPAC Name | — |
| SMILES | CCC(CC)C(=O)/C=C(\O)C(C)(CC)CC.[Ir].[c-]1ccc2cccc3c2c1-c1ncccc1O3 |
| InChI | InChI=1S/C15H8NO.C14H26O2.Ir/c1-4-10-5-2-7-12-14(10)11(6-1)15-13(17-12)8-3-9-16-15;1-6-11(7-2)12(15)10-13(16)14(5,8-3)9-4;/h1-5,7-9H;10-11,16H,6-9H2,1-5H3;/q-1;;/b;13-10-; |
| InChIKey | AJANMLWXUVYEEK-BEGQHWPVSA-N |
| XLogP | 8.07 |
| TPSA | 59.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 636.81 |
| LogP ≤ 5 | 8.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|