C29H34NO2+ — CID 166054033
14-(2,2-dimethylpropyl)-3,18,19-trimethyl-9-(2-methylpropyl)-7,11-dioxa-3-azoniapentacyclo[10.7.1.02,10.04,8.016,20]icosa-1(19),2,4(8),5,9,12,14,16(20),17-nonaene (PubChem CID 166054033) has the molecular formula C29H34NO2+ and a molecular weight of 428.60 g/mol. Its IUPAC name is 14-(2,2-dimethylpropyl)-3,18,19-trimethyl-9-(2-methylpropyl)-7,11-dioxa-3-azoniapentacyclo[10.7.1.02,10.04,8.016,20]icosa-1(19),2,4(8),5,9,12,14,16(20),17-nonaene.
| Compound Name | 14-(2,2-dimethylpropyl)-3,18,19-trimethyl-9-(2-methylpropyl)-7,11-dioxa-3-azoniapentacyclo[10.7.1.02,10.04,8.016,20]icosa-1(19),2,4(8),5,9,12,14,16(20),17-nonaene |
|---|---|
| PubChem CID | 166054033 |
| Molecular Formula | C29H34NO2+ |
| Molecular Weight | 428.60 g/mol |
| Exact Mass | 428.26 |
| IUPAC Name | 14-(2,2-dimethylpropyl)-3,18,19-trimethyl-9-(2-methylpropyl)-7,11-dioxa-3-azoniapentacyclo[10.7.1.02,10.04,8.016,20]icosa-1(19),2,4(8),5,9,12,14,16(20),17-nonaene |
| SMILES | Cc1cc2cc(CC(C)(C)C)cc3c2c(c1C)-c1c(c(CC(C)C)c2occc2[n+]1C)O3 |
| InChI | InChI=1S/C29H34NO2/c1-16(2)11-21-27-22(9-10-31-27)30(8)26-24-18(4)17(3)12-20-13-19(15-29(5,6)7)14-23(25(20)24)32-28(21)26/h9-10,12-14,16H,11,15H2,1-8H3/q+1 |
| InChIKey | AMHNBWODSQKMPI-UHFFFAOYSA-N |
| XLogP | 7.59 |
| TPSA | 26.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.60 |
| LogP ≤ 5 | 7.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|