C22H24NSSi+ — CID 166054887
trimethyl-[1-methyl-2-(3-methyl-1-benzothiophen-2-yl)quinolin-1-ium-4-yl]silane (PubChem CID 166054887) has the molecular formula C22H24NSSi+ and a molecular weight of 362.59 g/mol. Its IUPAC name is trimethyl-[1-methyl-2-(3-methyl-1-benzothiophen-2-yl)quinolin-1-ium-4-yl]silane.
| Compound Name | trimethyl-[1-methyl-2-(3-methyl-1-benzothiophen-2-yl)quinolin-1-ium-4-yl]silane |
|---|---|
| PubChem CID | 166054887 |
| Molecular Formula | C22H24NSSi+ |
| Molecular Weight | 362.59 g/mol |
| Exact Mass | 362.14 |
| IUPAC Name | trimethyl-[1-methyl-2-(3-methyl-1-benzothiophen-2-yl)quinolin-1-ium-4-yl]silane |
| SMILES | Cc1c(-c2cc([Si](C)(C)C)c3ccccc3[n+]2C)sc2ccccc12 |
| InChI | InChI=1S/C22H24NSSi/c1-15-16-10-7-9-13-20(16)24-22(15)19-14-21(25(3,4)5)17-11-6-8-12-18(17)23(19)2/h6-14H,1-5H3/q+1 |
| InChIKey | SRMQKBRCXLYVBH-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.59 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'het_pyridiniums_A(39)', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|