C19H19N4S+ — CID 156629462
2,3,6-trimethyl-5-(3-methyl-1-benzothiophen-2-yl)-8-(trideuteriomethyl)pyrazino[2,3-d]pyridazin-6-ium (PubChem CID 156629462) has the molecular formula C19H19N4S+ and a molecular weight of 338.47 g/mol. Its IUPAC name is 2,3,6-trimethyl-5-(3-methyl-1-benzothiophen-2-yl)-8-(trideuteriomethyl)pyrazino[2,3-d]pyridazin-6-ium.
| Compound Name | 2,3,6-trimethyl-5-(3-methyl-1-benzothiophen-2-yl)-8-(trideuteriomethyl)pyrazino[2,3-d]pyridazin-6-ium |
|---|---|
| PubChem CID | 156629462 |
| Molecular Formula | C19H19N4S+ |
| Molecular Weight | 338.47 g/mol |
| Exact Mass | 338.15 |
| IUPAC Name | 2,3,6-trimethyl-5-(3-methyl-1-benzothiophen-2-yl)-8-(trideuteriomethyl)pyrazino[2,3-d]pyridazin-6-ium |
| SMILES | [2H]C([2H])([2H])c1n[n+](C)c(-c2sc3ccccc3c2C)c2nc(C)c(C)nc12 |
| InChI | InChI=1S/C19H19N4S/c1-10-14-8-6-7-9-15(14)24-19(10)18-17-16(13(4)22-23(18)5)20-11(2)12(3)21-17/h6-9H,1-5H3/q+1/i4D3 |
| InChIKey | SKPZFGBOYAPHIS-GKOSEXJESA-N |
| XLogP | 3.96 |
| TPSA | 42.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.47 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|