C19H15NS — CID 123801597
CID 123801597 (PubChem CID 123801597) has the molecular formula C19H15NS and a molecular weight of 289.40 g/mol.
| Compound Name | CID 123801597 |
|---|---|
| PubChem CID | 123801597 |
| Molecular Formula | C19H15NS |
| Molecular Weight | 289.40 g/mol |
| Exact Mass | 289.09 |
| IUPAC Name | — |
| SMILES | [CH2-][n+]1ccc2ccccc2c1-c1sc2ccccc2c1C |
| InChI | InChI=1S/C19H15NS/c1-13-15-8-5-6-10-17(15)21-19(13)18-16-9-4-3-7-14(16)11-12-20(18)2/h3-12H,2H2,1H3 |
| InChIKey | BWQBGAUMMRDYED-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.40 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|