C21H17N4S+ — CID 156629485
2-methyl-1-(3-methyl-1-benzothiophen-2-yl)-4-(trideuteriomethyl)pyridazino[4,5-b]quinoxalin-2-ium (PubChem CID 156629485) has the molecular formula C21H17N4S+ and a molecular weight of 360.48 g/mol. Its IUPAC name is 2-methyl-1-(3-methyl-1-benzothiophen-2-yl)-4-(trideuteriomethyl)pyridazino[4,5-b]quinoxalin-2-ium.
| Compound Name | 2-methyl-1-(3-methyl-1-benzothiophen-2-yl)-4-(trideuteriomethyl)pyridazino[4,5-b]quinoxalin-2-ium |
|---|---|
| PubChem CID | 156629485 |
| Molecular Formula | C21H17N4S+ |
| Molecular Weight | 360.48 g/mol |
| Exact Mass | 360.14 |
| IUPAC Name | 2-methyl-1-(3-methyl-1-benzothiophen-2-yl)-4-(trideuteriomethyl)pyridazino[4,5-b]quinoxalin-2-ium |
| SMILES | [2H]C([2H])([2H])c1n[n+](C)c(-c2sc3ccccc3c2C)c2nc3ccccc3nc12 |
| InChI | InChI=1S/C21H17N4S/c1-12-14-8-4-7-11-17(14)26-21(12)20-19-18(13(2)24-25(20)3)22-15-9-5-6-10-16(15)23-19/h4-11H,1-3H3/q+1/i2D3 |
| InChIKey | SDBJWBNAAOKMPT-BMSJAHLVSA-N |
| XLogP | 4.50 |
| TPSA | 42.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.48 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|