C33H31ClF2N4O3 — CID 166055760
4-chloro-6-fluoro-5-(2-fluoro-6-hydroxyphenyl)-15-methyl-8-(4-methyl-2-propan-2-yl-3-pyridinyl)-14-prop-2-enoyl-8,14,17-triazatetracyclo[8.7.0.02,7.012,17]heptadeca-1(10),2,4,6-tetraen-9-one (PubChem CID 166055760) has the molecular formula C33H31ClF2N4O3 and a molecular weight of 605.09 g/mol. Its IUPAC name is 4-chloro-6-fluoro-5-(2-fluoro-6-hydroxyphenyl)-15-methyl-8-(4-methyl-2-propan-2-yl-3-pyridinyl)-14-prop-2-enoyl-8,14,17-triazatetracyclo[8.7.0.02,7.012,17]heptadeca-1(10),2,4,6-tetraen-9-one.
| Compound Name | 4-chloro-6-fluoro-5-(2-fluoro-6-hydroxyphenyl)-15-methyl-8-(4-methyl-2-propan-2-yl-3-pyridinyl)-14-prop-2-enoyl-8,14,17-triazatetracyclo[8.7.0.02,7.012,17]heptadeca-1(10),2,4,6-tetraen-9-one |
|---|---|
| PubChem CID | 166055760 |
| Molecular Formula | C33H31ClF2N4O3 |
| Molecular Weight | 605.09 g/mol |
| Exact Mass | 604.21 |
| IUPAC Name | 4-chloro-6-fluoro-5-(2-fluoro-6-hydroxyphenyl)-15-methyl-8-(4-methyl-2-propan-2-yl-3-pyridinyl)-14-prop-2-enoyl-8,14,17-triazatetracyclo[8.7.0.02,7.012,17]heptadeca-1(10),2,4,6-tetraen-9-one |
| SMILES | C=CC(=O)N1CC2Cc3c(c4cc(Cl)c(-c5c(O)cccc5F)c(F)c4n(-c4c(C)ccnc4C(C)C)c3=O)N2CC1C |
| InChI | InChI=1S/C33H31ClF2N4O3/c1-6-25(42)38-15-19-12-21-31(39(19)14-18(38)5)20-13-22(34)26(27-23(35)8-7-9-24(27)41)28(36)32(20)40(33(21)43)30-17(4)10-11-37-29(30)16(2)3/h6-11,13,16,18-19,41H,1,12,14-15H2,2-5H3 |
| InChIKey | DRGODPGAYZUMTF-UHFFFAOYSA-N |
| XLogP | 6.27 |
| TPSA | 78.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 605.09 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|