C33H32F3N5O2 — CID 166056526
5-(2-amino-6-fluorophenyl)-4,6-difluoro-15-methyl-8-(4-methyl-2-propan-2-yl-3-pyridinyl)-14-prop-2-enoyl-8,14,17-triazatetracyclo[8.7.0.02,7.012,17]heptadeca-1(10),2,4,6-tetraen-9-one (PubChem CID 166056526) has the molecular formula C33H32F3N5O2 and a molecular weight of 587.65 g/mol. Its IUPAC name is 5-(2-amino-6-fluorophenyl)-4,6-difluoro-15-methyl-8-(4-methyl-2-propan-2-yl-3-pyridinyl)-14-prop-2-enoyl-8,14,17-triazatetracyclo[8.7.0.02,7.012,17]heptadeca-1(10),2,4,6-tetraen-9-one.
| Compound Name | 5-(2-amino-6-fluorophenyl)-4,6-difluoro-15-methyl-8-(4-methyl-2-propan-2-yl-3-pyridinyl)-14-prop-2-enoyl-8,14,17-triazatetracyclo[8.7.0.02,7.012,17]heptadeca-1(10),2,4,6-tetraen-9-one |
|---|---|
| PubChem CID | 166056526 |
| Molecular Formula | C33H32F3N5O2 |
| Molecular Weight | 587.65 g/mol |
| Exact Mass | 587.25 |
| IUPAC Name | 5-(2-amino-6-fluorophenyl)-4,6-difluoro-15-methyl-8-(4-methyl-2-propan-2-yl-3-pyridinyl)-14-prop-2-enoyl-8,14,17-triazatetracyclo[8.7.0.02,7.012,17]heptadeca-1(10),2,4,6-tetraen-9-one |
| SMILES | C=CC(=O)N1CC2Cc3c(c4cc(F)c(-c5c(N)cccc5F)c(F)c4n(-c4c(C)ccnc4C(C)C)c3=O)N2CC1C |
| InChI | InChI=1S/C33H32F3N5O2/c1-6-25(42)39-15-19-12-21-31(40(19)14-18(39)5)20-13-23(35)27(26-22(34)8-7-9-24(26)37)28(36)32(20)41(33(21)43)30-17(4)10-11-38-29(30)16(2)3/h6-11,13,16,18-19H,1,12,14-15,37H2,2-5H3 |
| InChIKey | ISUXLGBDZKFJBM-UHFFFAOYSA-N |
| XLogP | 5.63 |
| TPSA | 84.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.65 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|