C13H17NOS — CID 166057237
2-(3-sulfanylcyclohexyl)benzamide (PubChem CID 166057237) has the molecular formula C13H17NOS and a molecular weight of 235.35 g/mol. Its IUPAC name is 2-(3-sulfanylcyclohexyl)benzamide.
| Compound Name | 2-(3-sulfanylcyclohexyl)benzamide |
|---|---|
| PubChem CID | 166057237 |
| Molecular Formula | C13H17NOS |
| Molecular Weight | 235.35 g/mol |
| Exact Mass | 235.10 |
| IUPAC Name | 2-(3-sulfanylcyclohexyl)benzamide |
| SMILES | NC(=O)c1ccccc1C1CCCC(S)C1 |
| InChI | InChI=1S/C13H17NOS/c14-13(15)12-7-2-1-6-11(12)9-4-3-5-10(16)8-9/h1-2,6-7,9-10,16H,3-5,8H2,(H2,14,15) |
| InChIKey | LLYSYOGZXZBSPN-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.35 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|