C16H14ClF2N3 — CID 166059230
5-(3,7-difluoroquinolin-8-yl)-6-ethylpyridin-2-amine;hydrochloride (PubChem CID 166059230) has the molecular formula C16H14ClF2N3 and a molecular weight of 321.76 g/mol. Its IUPAC name is 5-(3,7-difluoroquinolin-8-yl)-6-ethylpyridin-2-amine;hydrochloride.
| Compound Name | 5-(3,7-difluoroquinolin-8-yl)-6-ethylpyridin-2-amine;hydrochloride |
|---|---|
| PubChem CID | 166059230 |
| Molecular Formula | C16H14ClF2N3 |
| Molecular Weight | 321.76 g/mol |
| Exact Mass | 321.08 |
| IUPAC Name | 5-(3,7-difluoroquinolin-8-yl)-6-ethylpyridin-2-amine;hydrochloride |
| SMILES | CCc1nc(N)ccc1-c1c(F)ccc2cc(F)cnc12.Cl |
| InChI | InChI=1S/C16H13F2N3.ClH/c1-2-13-11(4-6-14(19)21-13)15-12(18)5-3-9-7-10(17)8-20-16(9)15;/h3-8H,2H2,1H3,(H2,19,21);1H |
| InChIKey | NJZTWSJGWWQQTJ-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 51.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.76 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |