C24H29N5O3 — CID 166062071
N-[[4-[4-(4-methylpiperidin-1-yl)anilino]phenyl]methyl]-3,5-dioxopiperazine-1-carboxamide (PubChem CID 166062071) has the molecular formula C24H29N5O3 and a molecular weight of 435.53 g/mol. Its IUPAC name is N-[[4-[4-(4-methylpiperidin-1-yl)anilino]phenyl]methyl]-3,5-dioxopiperazine-1-carboxamide.
| Compound Name | N-[[4-[4-(4-methylpiperidin-1-yl)anilino]phenyl]methyl]-3,5-dioxopiperazine-1-carboxamide |
|---|---|
| PubChem CID | 166062071 |
| Molecular Formula | C24H29N5O3 |
| Molecular Weight | 435.53 g/mol |
| Exact Mass | 435.23 |
| IUPAC Name | N-[[4-[4-(4-methylpiperidin-1-yl)anilino]phenyl]methyl]-3,5-dioxopiperazine-1-carboxamide |
| SMILES | CC1CCN(c2ccc(Nc3ccc(CNC(=O)N4CC(=O)NC(=O)C4)cc3)cc2)CC1 |
| InChI | InChI=1S/C24H29N5O3/c1-17-10-12-28(13-11-17)21-8-6-20(7-9-21)26-19-4-2-18(3-5-19)14-25-24(32)29-15-22(30)27-23(31)16-29/h2-9,17,26H,10-16H2,1H3,(H,25,32)(H,27,30,31) |
| InChIKey | QDRCLCQXZIXPCL-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 93.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.53 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|