C26H34F3N5O — CID 166062469
2-(4-methylpiperazin-1-yl)-N-[[4-(4-piperidin-1-ylanilino)-2-(trifluoromethyl)phenyl]methyl]acetamide (PubChem CID 166062469) has the molecular formula C26H34F3N5O and a molecular weight of 489.59 g/mol. Its IUPAC name is 2-(4-methylpiperazin-1-yl)-N-[[4-(4-piperidin-1-ylanilino)-2-(trifluoromethyl)phenyl]methyl]acetamide.
| Compound Name | 2-(4-methylpiperazin-1-yl)-N-[[4-(4-piperidin-1-ylanilino)-2-(trifluoromethyl)phenyl]methyl]acetamide |
|---|---|
| PubChem CID | 166062469 |
| Molecular Formula | C26H34F3N5O |
| Molecular Weight | 489.59 g/mol |
| Exact Mass | 489.27 |
| IUPAC Name | 2-(4-methylpiperazin-1-yl)-N-[[4-(4-piperidin-1-ylanilino)-2-(trifluoromethyl)phenyl]methyl]acetamide |
| SMILES | CN1CCN(CC(=O)NCc2ccc(Nc3ccc(N4CCCCC4)cc3)cc2C(F)(F)F)CC1 |
| InChI | InChI=1S/C26H34F3N5O/c1-32-13-15-33(16-14-32)19-25(35)30-18-20-5-6-22(17-24(20)26(27,28)29)31-21-7-9-23(10-8-21)34-11-3-2-4-12-34/h5-10,17,31H,2-4,11-16,18-19H2,1H3,(H,30,35) |
| InChIKey | DJDZOYDPVRXKHZ-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 50.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.59 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|