C25H29F3N4O3 — CID 166062567
N-hydroxy-1-methyl-5-oxo-N-[[4-(4-piperidin-1-ylanilino)-2-(trifluoromethyl)phenyl]methyl]pyrrolidine-3-carboxamide (PubChem CID 166062567) has the molecular formula C25H29F3N4O3 and a molecular weight of 490.53 g/mol. Its IUPAC name is N-hydroxy-1-methyl-5-oxo-N-[[4-(4-piperidin-1-ylanilino)-2-(trifluoromethyl)phenyl]methyl]pyrrolidine-3-carboxamide.
| Compound Name | N-hydroxy-1-methyl-5-oxo-N-[[4-(4-piperidin-1-ylanilino)-2-(trifluoromethyl)phenyl]methyl]pyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 166062567 |
| Molecular Formula | C25H29F3N4O3 |
| Molecular Weight | 490.53 g/mol |
| Exact Mass | 490.22 |
| IUPAC Name | N-hydroxy-1-methyl-5-oxo-N-[[4-(4-piperidin-1-ylanilino)-2-(trifluoromethyl)phenyl]methyl]pyrrolidine-3-carboxamide |
| SMILES | CN1CC(C(=O)N(O)Cc2ccc(Nc3ccc(N4CCCCC4)cc3)cc2C(F)(F)F)CC1=O |
| InChI | InChI=1S/C25H29F3N4O3/c1-30-15-18(13-23(30)33)24(34)32(35)16-17-5-6-20(14-22(17)25(26,27)28)29-19-7-9-21(10-8-19)31-11-3-2-4-12-31/h5-10,14,18,29,35H,2-4,11-13,15-16H2,1H3 |
| InChIKey | VKGJWSKTWNOYGK-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 76.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.53 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|