C23H31N3O2 — CID 168752934
N-hydroxy-2,2-dimethyl-N-[[4-(4-piperidin-1-ylanilino)phenyl]methyl]propanamide (PubChem CID 168752934) has the molecular formula C23H31N3O2 and a molecular weight of 381.52 g/mol. Its IUPAC name is N-hydroxy-2,2-dimethyl-N-[[4-(4-piperidin-1-ylanilino)phenyl]methyl]propanamide.
| Compound Name | N-hydroxy-2,2-dimethyl-N-[[4-(4-piperidin-1-ylanilino)phenyl]methyl]propanamide |
|---|---|
| PubChem CID | 168752934 |
| Molecular Formula | C23H31N3O2 |
| Molecular Weight | 381.52 g/mol |
| Exact Mass | 381.24 |
| IUPAC Name | N-hydroxy-2,2-dimethyl-N-[[4-(4-piperidin-1-ylanilino)phenyl]methyl]propanamide |
| SMILES | CC(C)(C)C(=O)N(O)Cc1ccc(Nc2ccc(N3CCCCC3)cc2)cc1 |
| InChI | InChI=1S/C23H31N3O2/c1-23(2,3)22(27)26(28)17-18-7-9-19(10-8-18)24-20-11-13-21(14-12-20)25-15-5-4-6-16-25/h7-14,24,28H,4-6,15-17H2,1-3H3 |
| InChIKey | GUVIWFVFTRFQGD-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 55.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.52 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|