C28H31FN2O2 — CID 166062589
N-[[4-(4-tert-butyl-3-fluoroanilino)phenyl]methyl]-N-hydroxy-5,6,7,8-tetrahydronaphthalene-2-carboxamide (PubChem CID 166062589) has the molecular formula C28H31FN2O2 and a molecular weight of 446.57 g/mol. Its IUPAC name is N-[[4-(4-tert-butyl-3-fluoroanilino)phenyl]methyl]-N-hydroxy-5,6,7,8-tetrahydronaphthalene-2-carboxamide.
| Compound Name | N-[[4-(4-tert-butyl-3-fluoroanilino)phenyl]methyl]-N-hydroxy-5,6,7,8-tetrahydronaphthalene-2-carboxamide |
|---|---|
| PubChem CID | 166062589 |
| Molecular Formula | C28H31FN2O2 |
| Molecular Weight | 446.57 g/mol |
| Exact Mass | 446.24 |
| IUPAC Name | N-[[4-(4-tert-butyl-3-fluoroanilino)phenyl]methyl]-N-hydroxy-5,6,7,8-tetrahydronaphthalene-2-carboxamide |
| SMILES | CC(C)(C)c1ccc(Nc2ccc(CN(O)C(=O)c3ccc4c(c3)CCCC4)cc2)cc1F |
| InChI | InChI=1S/C28H31FN2O2/c1-28(2,3)25-15-14-24(17-26(25)29)30-23-12-8-19(9-13-23)18-31(33)27(32)22-11-10-20-6-4-5-7-21(20)16-22/h8-17,30,33H,4-7,18H2,1-3H3 |
| InChIKey | ZATUOOBOOVHSFT-UHFFFAOYSA-N |
| XLogP | 6.78 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.57 |
| LogP ≤ 5 | 6.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|