C7H7AgF3NO4 — CID 166063775
silver 3-amino-1-carboxy-3-(trifluoromethyl)cyclobutane-1-carboxylate (PubChem CID 166063775) has the molecular formula C7H7AgF3NO4 and a molecular weight of 334.00 g/mol. Its IUPAC name is silver 3-amino-1-carboxy-3-(trifluoromethyl)cyclobutane-1-carboxylate.
| Compound Name | silver 3-amino-1-carboxy-3-(trifluoromethyl)cyclobutane-1-carboxylate |
|---|---|
| PubChem CID | 166063775 |
| Molecular Formula | C7H7AgF3NO4 |
| Molecular Weight | 334.00 g/mol |
| Exact Mass | 332.94 |
| IUPAC Name | silver 3-amino-1-carboxy-3-(trifluoromethyl)cyclobutane-1-carboxylate |
| SMILES | NC1(C(F)(F)F)CC(C(=O)[O-])(C(=O)O)C1.[Ag+] |
| InChI | InChI=1S/C7H8F3NO4.Ag/c8-7(9,10)6(11)1-5(2-6,3(12)13)4(14)15;/h1-2,11H2,(H,12,13)(H,14,15);/q;+1/p-1 |
| InChIKey | KFGKDRLDCJCQRG-UHFFFAOYSA-M |
| XLogP | -1.14 |
| TPSA | 103.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.00 |
| LogP ≤ 5 | -1.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|