C6H9ClF3NO3 — CID 135397437
1-amino-3-hydroxy-3-(trifluoromethyl)cyclobutane-1-carboxylic acid;hydrochloride (PubChem CID 135397437) has the molecular formula C6H9ClF3NO3 and a molecular weight of 235.59 g/mol. Its IUPAC name is 1-amino-3-hydroxy-3-(trifluoromethyl)cyclobutane-1-carboxylic acid;hydrochloride.
| Compound Name | 1-amino-3-hydroxy-3-(trifluoromethyl)cyclobutane-1-carboxylic acid;hydrochloride |
|---|---|
| PubChem CID | 135397437 |
| Molecular Formula | C6H9ClF3NO3 |
| Molecular Weight | 235.59 g/mol |
| Exact Mass | 235.02 |
| IUPAC Name | 1-amino-3-hydroxy-3-(trifluoromethyl)cyclobutane-1-carboxylic acid;hydrochloride |
| SMILES | Cl.NC1(C(=O)O)CC(O)(C(F)(F)F)C1 |
| InChI | InChI=1S/C6H8F3NO3.ClH/c7-6(8,9)5(13)1-4(10,2-5)3(11)12;/h13H,1-2,10H2,(H,11,12);1H |
| InChIKey | UNBDEHJTWYINQJ-UHFFFAOYSA-N |
| XLogP | 0.28 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.59 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |