C8H12F3NO2 — CID 22561606
1-amino-4-(trifluoromethyl)cyclohexane-1-carboxylic acid (PubChem CID 22561606) has the molecular formula C8H12F3NO2 and a molecular weight of 211.18 g/mol. Its IUPAC name is 1-amino-4-(trifluoromethyl)cyclohexane-1-carboxylic acid.
| Compound Name | 1-amino-4-(trifluoromethyl)cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 22561606 |
| Molecular Formula | C8H12F3NO2 |
| Molecular Weight | 211.18 g/mol |
| Exact Mass | 211.08 |
| IUPAC Name | 1-amino-4-(trifluoromethyl)cyclohexane-1-carboxylic acid |
| SMILES | NC1(C(=O)O)CCC(C(F)(F)F)CC1 |
| InChI | InChI=1S/C8H12F3NO2/c9-8(10,11)5-1-3-7(12,4-2-5)6(13)14/h5H,1-4,12H2,(H,13,14) |
| InChIKey | UHFDZVXSXVVKAI-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.18 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |