C9H12F3NO3 — CID 64756305
1-formamido-4-(trifluoromethyl)cyclohexane-1-carboxylic acid (PubChem CID 64756305) has the molecular formula C9H12F3NO3 and a molecular weight of 239.19 g/mol. Its IUPAC name is 1-formamido-4-(trifluoromethyl)cyclohexane-1-carboxylic acid.
| Compound Name | 1-formamido-4-(trifluoromethyl)cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 64756305 |
| Molecular Formula | C9H12F3NO3 |
| Molecular Weight | 239.19 g/mol |
| Exact Mass | 239.08 |
| IUPAC Name | 1-formamido-4-(trifluoromethyl)cyclohexane-1-carboxylic acid |
| SMILES | O=CNC1(C(=O)O)CCC(C(F)(F)F)CC1 |
| InChI | InChI=1S/C9H12F3NO3/c10-9(11,12)6-1-3-8(4-2-6,7(15)16)13-5-14/h5-6H,1-4H2,(H,13,14)(H,15,16) |
| InChIKey | BPUILKDCBJWGJZ-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.19 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|