C13H21F3N2O2 — CID 65419678
1-(4-methylpiperazin-1-yl)-4-(trifluoromethyl)cyclohexane-1-carboxylic acid (PubChem CID 65419678) has the molecular formula C13H21F3N2O2 and a molecular weight of 294.32 g/mol. Its IUPAC name is 1-(4-methylpiperazin-1-yl)-4-(trifluoromethyl)cyclohexane-1-carboxylic acid.
| Compound Name | 1-(4-methylpiperazin-1-yl)-4-(trifluoromethyl)cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 65419678 |
| Molecular Formula | C13H21F3N2O2 |
| Molecular Weight | 294.32 g/mol |
| Exact Mass | 294.16 |
| IUPAC Name | 1-(4-methylpiperazin-1-yl)-4-(trifluoromethyl)cyclohexane-1-carboxylic acid |
| SMILES | CN1CCN(C2(C(=O)O)CCC(C(F)(F)F)CC2)CC1 |
| InChI | InChI=1S/C13H21F3N2O2/c1-17-6-8-18(9-7-17)12(11(19)20)4-2-10(3-5-12)13(14,15)16/h10H,2-9H2,1H3,(H,19,20) |
| InChIKey | PFTNLRJMLFRDNX-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 43.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.32 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |