C27H29ClN6O2S — CID 166063988
N-[5-[[4-(1-benzothiophen-3-yl)pyrimidin-2-yl]amino]-4-methoxy-2-(4-methylpiperazin-1-yl)phenyl]-3-chloropropanamide (PubChem CID 166063988) has the molecular formula C27H29ClN6O2S and a molecular weight of 537.09 g/mol. Its IUPAC name is N-[5-[[4-(1-benzothiophen-3-yl)pyrimidin-2-yl]amino]-4-methoxy-2-(4-methylpiperazin-1-yl)phenyl]-3-chloropropanamide.
| Compound Name | N-[5-[[4-(1-benzothiophen-3-yl)pyrimidin-2-yl]amino]-4-methoxy-2-(4-methylpiperazin-1-yl)phenyl]-3-chloropropanamide |
|---|---|
| PubChem CID | 166063988 |
| Molecular Formula | C27H29ClN6O2S |
| Molecular Weight | 537.09 g/mol |
| Exact Mass | 536.18 |
| IUPAC Name | N-[5-[[4-(1-benzothiophen-3-yl)pyrimidin-2-yl]amino]-4-methoxy-2-(4-methylpiperazin-1-yl)phenyl]-3-chloropropanamide |
| SMILES | COc1cc(N2CCN(C)CC2)c(NC(=O)CCCl)cc1Nc1nccc(-c2csc3ccccc23)n1 |
| InChI | InChI=1S/C27H29ClN6O2S/c1-33-11-13-34(14-12-33)23-16-24(36-2)22(15-21(23)30-26(35)7-9-28)32-27-29-10-8-20(31-27)19-17-37-25-6-4-3-5-18(19)25/h3-6,8,10,15-17H,7,9,11-14H2,1-2H3,(H,30,35)(H,29,31,32) |
| InChIKey | PWAZOQFDYBGWDH-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 82.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.09 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|