C22H19NO — CID 166064540
3-[3-(3,5-dimethylphenyl)phenyl]-1-pyridin-2-ylprop-2-en-1-one (PubChem CID 166064540) has the molecular formula C22H19NO and a molecular weight of 313.40 g/mol. Its IUPAC name is 3-[3-(3,5-dimethylphenyl)phenyl]-1-pyridin-2-ylprop-2-en-1-one.
| Compound Name | 3-[3-(3,5-dimethylphenyl)phenyl]-1-pyridin-2-ylprop-2-en-1-one |
|---|---|
| PubChem CID | 166064540 |
| Molecular Formula | C22H19NO |
| Molecular Weight | 313.40 g/mol |
| Exact Mass | 313.15 |
| IUPAC Name | 3-[3-(3,5-dimethylphenyl)phenyl]-1-pyridin-2-ylprop-2-en-1-one |
| SMILES | Cc1cc(C)cc(-c2cccc(C=CC(=O)c3ccccn3)c2)c1 |
| InChI | InChI=1S/C22H19NO/c1-16-12-17(2)14-20(13-16)19-7-5-6-18(15-19)9-10-22(24)21-8-3-4-11-23-21/h3-15H,1-2H3 |
| InChIKey | ZRNLCHFXKLJEOT-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.40 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|