C19H20N2 — CID 142200263
(2E,4Z)-N,3-dimethyl-5-(3-methylphenyl)-1-pyridin-2-ylpenta-2,4-dien-1-imine (PubChem CID 142200263) has the molecular formula C19H20N2 and a molecular weight of 276.38 g/mol. Its IUPAC name is (2E,4Z)-N,3-dimethyl-5-(3-methylphenyl)-1-pyridin-2-ylpenta-2,4-dien-1-imine.
| Compound Name | (2E,4Z)-N,3-dimethyl-5-(3-methylphenyl)-1-pyridin-2-ylpenta-2,4-dien-1-imine |
|---|---|
| PubChem CID | 142200263 |
| Molecular Formula | C19H20N2 |
| Molecular Weight | 276.38 g/mol |
| Exact Mass | 276.16 |
| IUPAC Name | (2E,4Z)-N,3-dimethyl-5-(3-methylphenyl)-1-pyridin-2-ylpenta-2,4-dien-1-imine |
| SMILES | C/N=C(/C=C(C)/C=C\c1cccc(C)c1)c1ccccn1 |
| InChI | InChI=1S/C19H20N2/c1-15-7-6-8-17(13-15)11-10-16(2)14-19(20-3)18-9-4-5-12-21-18/h4-14H,1-3H3/b11-10-,16-14+,20-19- |
| InChIKey | ZTFWZVQEZJOBGD-GVQSRXRMSA-N |
| XLogP | 4.47 |
| TPSA | 25.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.38 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|