C41H37O5P — CID 166066960
2-[2-[2,6-bis(2,6-dimethoxyphenyl)phenyl]-6-phenylphenyl]phosphanyl-4-methylphenol (PubChem CID 166066960) has the molecular formula C41H37O5P and a molecular weight of 640.72 g/mol. Its IUPAC name is 2-[2-[2,6-bis(2,6-dimethoxyphenyl)phenyl]-6-phenylphenyl]phosphanyl-4-methylphenol.
| Compound Name | 2-[2-[2,6-bis(2,6-dimethoxyphenyl)phenyl]-6-phenylphenyl]phosphanyl-4-methylphenol |
|---|---|
| PubChem CID | 166066960 |
| Molecular Formula | C41H37O5P |
| Molecular Weight | 640.72 g/mol |
| Exact Mass | 640.24 |
| IUPAC Name | 2-[2-[2,6-bis(2,6-dimethoxyphenyl)phenyl]-6-phenylphenyl]phosphanyl-4-methylphenol |
| SMILES | COc1cccc(OC)c1-c1cccc(-c2c(OC)cccc2OC)c1-c1cccc(-c2ccccc2)c1Pc1cc(C)ccc1O |
| InChI | InChI=1S/C41H37O5P/c1-26-23-24-32(42)37(25-26)47-41-28(27-13-7-6-8-14-27)15-9-18-31(41)38-29(39-33(43-2)19-11-20-34(39)44-3)16-10-17-30(38)40-35(45-4)21-12-22-36(40)46-5/h6-25,42,47H,1-5H3 |
| InChIKey | NVEJGZZMKQIXPP-UHFFFAOYSA-N |
| XLogP | 9.03 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 640.72 |
| LogP ≤ 5 | 9.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|