C22H20BrN3 — CID 166067981
4-[[2-(4-bromophenyl)imidazo[1,2-a]pyridin-3-yl]methyl]-N,N-dimethylaniline (PubChem CID 166067981) has the molecular formula C22H20BrN3 and a molecular weight of 406.33 g/mol. Its IUPAC name is 4-[[2-(4-bromophenyl)imidazo[1,2-a]pyridin-3-yl]methyl]-N,N-dimethylaniline.
| Compound Name | 4-[[2-(4-bromophenyl)imidazo[1,2-a]pyridin-3-yl]methyl]-N,N-dimethylaniline |
|---|---|
| PubChem CID | 166067981 |
| Molecular Formula | C22H20BrN3 |
| Molecular Weight | 406.33 g/mol |
| Exact Mass | 405.08 |
| IUPAC Name | 4-[[2-(4-bromophenyl)imidazo[1,2-a]pyridin-3-yl]methyl]-N,N-dimethylaniline |
| SMILES | CN(C)c1ccc(Cc2c(-c3ccc(Br)cc3)nc3ccccn23)cc1 |
| InChI | InChI=1S/C22H20BrN3/c1-25(2)19-12-6-16(7-13-19)15-20-22(17-8-10-18(23)11-9-17)24-21-5-3-4-14-26(20)21/h3-14H,15H2,1-2H3 |
| InChIKey | MSQGTBIJMIYZFM-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 20.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.33 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|