About 4-[2-(4-fluorophenyl)-5-methyl-6,7-dihydro-4H-pyrazolo[1,5-a]pyrazin-3-yl]pyrimidin-2-amine
4-[2-(4-fluorophenyl)-5-methyl-6,7-dihydro-4H-pyrazolo[1,5-a]pyrazin-3-yl]pyrimidin-2-amine (PubChem CID 166068461) has the molecular formula C17H17FN6
and a molecular weight of 324.36 g/mol. Its IUPAC name is 4-[2-(4-fluorophenyl)-5-methyl-6,7-dihydro-4H-pyrazolo[1,5-a]pyrazin-3-yl]pyrimidin-2-amine.
Molecular Properties
| Compound Name | 4-[2-(4-fluorophenyl)-5-methyl-6,7-dihydro-4H-pyrazolo[1,5-a]pyrazin-3-yl]pyrimidin-2-amine |
| PubChem CID | 166068461 |
| Molecular Formula | C17H17FN6 |
| Molecular Weight | 324.36 g/mol |
| Exact Mass | 324.15 |
| IUPAC Name | 4-[2-(4-fluorophenyl)-5-methyl-6,7-dihydro-4H-pyrazolo[1,5-a]pyrazin-3-yl]pyrimidin-2-amine |
| SMILES | CN1CCn2nc(-c3ccc(F)cc3)c(-c3ccnc(N)n3)c2C1 |
| InChI | InChI=1S/C17H17FN6/c1-23-8-9-24-14(10-23)15(13-6-7-20-17(19)21-13)16(22-24)11-2-4-12(18)5-3-11/h2-7H,8-10H2,1H3,(H2,19,20,21) |
| InChIKey | OZWWWVMPXOCMHN-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 72.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 324.36 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 4-[2-(4-fluorophenyl)-5-methyl-6,7-dihydro-4H-pyrazolo[1,5-a]pyrazin-3-yl]pyrimidin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[2-(4-fluorophenyl)-5-methyl-6,7-dihydro-4H-pyrazolo[1,5-a]pyrazin-3-yl]pyrimidin-2-amine?
The IUPAC name of 4-[2-(4-fluorophenyl)-5-methyl-6,7-dihydro-4H-pyrazolo[1,5-a]pyrazin-3-yl]pyrimidin-2-amine (CID 166068461) is 4-[2-(4-fluorophenyl)-5-methyl-6,7-dihydro-4H-pyrazolo[1,5-a]pyrazin-3-yl]pyrimidin-2-amine.
What is the SMILES notation for 4-[2-(4-fluorophenyl)-5-methyl-6,7-dihydro-4H-pyrazolo[1,5-a]pyrazin-3-yl]pyrimidin-2-amine?
The canonical SMILES for 4-[2-(4-fluorophenyl)-5-methyl-6,7-dihydro-4H-pyrazolo[1,5-a]pyrazin-3-yl]pyrimidin-2-amine is CN1CCn2nc(-c3ccc(F)cc3)c(-c3ccnc(N)n3)c2C1.
What is the InChIKey of 4-[2-(4-fluorophenyl)-5-methyl-6,7-dihydro-4H-pyrazolo[1,5-a]pyrazin-3-yl]pyrimidin-2-amine?
The InChIKey is OZWWWVMPXOCMHN-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H17FN6/c1-23-8-9-24-14(10-23)15(13-6-7-20-17(19)21-13)16(22-24)11-2-4-12(18)5-3-11/h2-7H,8-10H2,1H3,(H2,19,20,21).
What are the key properties of 4-[2-(4-fluorophenyl)-5-methyl-6,7-dihydro-4H-pyrazolo[1,5-a]pyrazin-3-yl]pyrimidin-2-amine?
4-[2-(4-fluorophenyl)-5-methyl-6,7-dihydro-4H-pyrazolo[1,5-a]pyrazin-3-yl]pyrimidin-2-amine has a molecular weight of 324.36 g/mol, XLogP of 2.17, 2 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[2-(4-fluorophenyl)-5-methyl-6,7-dihydro-4H-pyrazolo[1,5-a]pyrazin-3-yl]pyrimidin-2-amine is sourced from PubChem (CID 166068461), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).