C19H18FN5S — CID 167130627
1-[3-(2-amino-4-pyridinyl)-2-(4-fluorophenyl)-6,7-dihydro-4H-pyrazolo[1,5-a]pyrazin-5-yl]ethanethione (PubChem CID 167130627) has the molecular formula C19H18FN5S and a molecular weight of 367.45 g/mol. Its IUPAC name is 1-[3-(2-amino-4-pyridinyl)-2-(4-fluorophenyl)-6,7-dihydro-4H-pyrazolo[1,5-a]pyrazin-5-yl]ethanethione.
| Compound Name | 1-[3-(2-amino-4-pyridinyl)-2-(4-fluorophenyl)-6,7-dihydro-4H-pyrazolo[1,5-a]pyrazin-5-yl]ethanethione |
|---|---|
| PubChem CID | 167130627 |
| Molecular Formula | C19H18FN5S |
| Molecular Weight | 367.45 g/mol |
| Exact Mass | 367.13 |
| IUPAC Name | 1-[3-(2-amino-4-pyridinyl)-2-(4-fluorophenyl)-6,7-dihydro-4H-pyrazolo[1,5-a]pyrazin-5-yl]ethanethione |
| SMILES | CC(=S)N1CCn2nc(-c3ccc(F)cc3)c(-c3ccnc(N)c3)c2C1 |
| InChI | InChI=1S/C19H18FN5S/c1-12(26)24-8-9-25-16(11-24)18(14-6-7-22-17(21)10-14)19(23-25)13-2-4-15(20)5-3-13/h2-7,10H,8-9,11H2,1H3,(H2,21,22) |
| InChIKey | TYMRNPJKHXIHSW-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 59.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.45 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|