C21H17FN4O — CID 170327905
1-[2-(4-fluorophenyl)-3-pyridin-4-yl-6,7-dihydro-4H-pyrazolo[1,5-a]pyrazin-5-yl]but-2-yn-1-one (PubChem CID 170327905) has the molecular formula C21H17FN4O and a molecular weight of 360.39 g/mol. Its IUPAC name is 1-[2-(4-fluorophenyl)-3-pyridin-4-yl-6,7-dihydro-4H-pyrazolo[1,5-a]pyrazin-5-yl]but-2-yn-1-one.
| Compound Name | 1-[2-(4-fluorophenyl)-3-pyridin-4-yl-6,7-dihydro-4H-pyrazolo[1,5-a]pyrazin-5-yl]but-2-yn-1-one |
|---|---|
| PubChem CID | 170327905 |
| Molecular Formula | C21H17FN4O |
| Molecular Weight | 360.39 g/mol |
| Exact Mass | 360.14 |
| IUPAC Name | 1-[2-(4-fluorophenyl)-3-pyridin-4-yl-6,7-dihydro-4H-pyrazolo[1,5-a]pyrazin-5-yl]but-2-yn-1-one |
| SMILES | CC#CC(=O)N1CCn2nc(-c3ccc(F)cc3)c(-c3ccncc3)c2C1 |
| InChI | InChI=1S/C21H17FN4O/c1-2-3-19(27)25-12-13-26-18(14-25)20(15-8-10-23-11-9-15)21(24-26)16-4-6-17(22)7-5-16/h4-11H,12-14H2,1H3 |
| InChIKey | ICJZXKYVRQEXON-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 51.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.39 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|