C16H14N4O2 — CID 166070085
6-cyano-4-(propan-2-ylamino)-9H-pyrido[2,3-b]indole-3-carboxylic acid (PubChem CID 166070085) has the molecular formula C16H14N4O2 and a molecular weight of 294.31 g/mol. Its IUPAC name is 6-cyano-4-(propan-2-ylamino)-9H-pyrido[2,3-b]indole-3-carboxylic acid.
| Compound Name | 6-cyano-4-(propan-2-ylamino)-9H-pyrido[2,3-b]indole-3-carboxylic acid |
|---|---|
| PubChem CID | 166070085 |
| Molecular Formula | C16H14N4O2 |
| Molecular Weight | 294.31 g/mol |
| Exact Mass | 294.11 |
| IUPAC Name | 6-cyano-4-(propan-2-ylamino)-9H-pyrido[2,3-b]indole-3-carboxylic acid |
| SMILES | CC(C)Nc1c(C(=O)O)cnc2[nH]c3ccc(C#N)cc3c12 |
| InChI | InChI=1S/C16H14N4O2/c1-8(2)19-14-11(16(21)22)7-18-15-13(14)10-5-9(6-17)3-4-12(10)20-15/h3-5,7-8H,1-2H3,(H,21,22)(H2,18,19,20) |
| InChIKey | HZNQYKWXPBYYEX-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 101.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.31 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |