C12H14ClN5O — CID 166071509
(2S,6R)-4-(5-cyanopyrimidin-2-yl)-2,6-dimethylpiperazine-1-carbonyl chloride (PubChem CID 166071509) has the molecular formula C12H14ClN5O and a molecular weight of 279.73 g/mol. Its IUPAC name is (2S,6R)-4-(5-cyanopyrimidin-2-yl)-2,6-dimethylpiperazine-1-carbonyl chloride.
| Compound Name | (2S,6R)-4-(5-cyanopyrimidin-2-yl)-2,6-dimethylpiperazine-1-carbonyl chloride |
|---|---|
| PubChem CID | 166071509 |
| Molecular Formula | C12H14ClN5O |
| Molecular Weight | 279.73 g/mol |
| Exact Mass | 279.09 |
| IUPAC Name | (2S,6R)-4-(5-cyanopyrimidin-2-yl)-2,6-dimethylpiperazine-1-carbonyl chloride |
| SMILES | C[C@@H]1CN(c2ncc(C#N)cn2)C[C@H](C)N1C(=O)Cl |
| InChI | InChI=1S/C12H14ClN5O/c1-8-6-17(7-9(2)18(8)11(13)19)12-15-4-10(3-14)5-16-12/h4-5,8-9H,6-7H2,1-2H3/t8-,9+ |
| InChIKey | JVCPOQDSNMANEP-DTORHVGOSA-N |
| XLogP | 1.61 |
| TPSA | 73.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.73 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|