C13H19ClN4O3S — CID 167450297
(2S,6R)-4-(5-ethylsulfonylpyrimidin-2-yl)-2,6-dimethylpiperazine-1-carbonyl chloride (PubChem CID 167450297) has the molecular formula C13H19ClN4O3S and a molecular weight of 346.84 g/mol. Its IUPAC name is (2S,6R)-4-(5-ethylsulfonylpyrimidin-2-yl)-2,6-dimethylpiperazine-1-carbonyl chloride.
| Compound Name | (2S,6R)-4-(5-ethylsulfonylpyrimidin-2-yl)-2,6-dimethylpiperazine-1-carbonyl chloride |
|---|---|
| PubChem CID | 167450297 |
| Molecular Formula | C13H19ClN4O3S |
| Molecular Weight | 346.84 g/mol |
| Exact Mass | 346.09 |
| IUPAC Name | (2S,6R)-4-(5-ethylsulfonylpyrimidin-2-yl)-2,6-dimethylpiperazine-1-carbonyl chloride |
| SMILES | CCS(=O)(=O)c1cnc(N2C[C@@H](C)N(C(=O)Cl)[C@@H](C)C2)nc1 |
| InChI | InChI=1S/C13H19ClN4O3S/c1-4-22(20,21)11-5-15-13(16-6-11)17-7-9(2)18(12(14)19)10(3)8-17/h5-6,9-10H,4,7-8H2,1-3H3/t9-,10+ |
| InChIKey | JEGIBOFVHYDXKG-AOOOYVTPSA-N |
| XLogP | 1.53 |
| TPSA | 83.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.84 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|