C12H17FN4O4S — CID 134552969
ethyl (3R,5R)-1-(5-fluoropyrimidin-2-yl)-5-sulfamoylpiperidine-3-carboxylate (PubChem CID 134552969) has the molecular formula C12H17FN4O4S and a molecular weight of 332.36 g/mol. Its IUPAC name is ethyl (3R,5R)-1-(5-fluoropyrimidin-2-yl)-5-sulfamoylpiperidine-3-carboxylate.
| Compound Name | ethyl (3R,5R)-1-(5-fluoropyrimidin-2-yl)-5-sulfamoylpiperidine-3-carboxylate |
|---|---|
| PubChem CID | 134552969 |
| Molecular Formula | C12H17FN4O4S |
| Molecular Weight | 332.36 g/mol |
| Exact Mass | 332.10 |
| IUPAC Name | ethyl (3R,5R)-1-(5-fluoropyrimidin-2-yl)-5-sulfamoylpiperidine-3-carboxylate |
| SMILES | CCOC(=O)[C@@H]1C[C@@H](S(N)(=O)=O)CN(c2ncc(F)cn2)C1 |
| InChI | InChI=1S/C12H17FN4O4S/c1-2-21-11(18)8-3-10(22(14,19)20)7-17(6-8)12-15-4-9(13)5-16-12/h4-5,8,10H,2-3,6-7H2,1H3,(H2,14,19,20)/t8-,10-/m1/s1 |
| InChIKey | JLEZZAACKLTOEL-PSASIEDQSA-N |
| XLogP | -0.34 |
| TPSA | 115.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.36 |
| LogP ≤ 5 | -0.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |